Sulfate chloride
The sulfate chlorides are double salts containing both sulfate (SO42–) and chloride (Cl–) anions. They are distinct from the chlorosulfates, which have a chlorine atom attached to the sulfur as the ClSO3− anion.
| Identifiers | |
|---|---|
3D model (JSmol) |
|
PubChem CID |
|
| |
| |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
| Infobox references | |
Many minerals in this family exist. Many are found associated with volcanoes and fumaroles. As minerals they are included in the Nickel-Strunz classification group 7.DG.
The book, Hey's Chemical Index of Minerals groups these in subgroup 12.2.
List
| name | formula | ratio | system | space group | unit cell | volume | density | optical | references |
|---|---|---|---|---|---|---|---|---|---|
| Arzrunite | Cu4Pb2(SO4)(OH)4Cl6 · 2H2O (?) | 1:6 | orthorhombic | Blue Biaxial | [1] | ||||
| Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O | 1:4 | hexagonal | P62c | a = 15.78 c = 9.10 | 1,962 | 3.36 | blue
Uniaxial (+) nω = 1.724 - 1.746 nε = 1.738 - 1.758 Birefringence: 0.026 |
[2] |
| Potassium Zinc Sulfate Chloride | K2Zn(SO4)Cl3 ? | 1:3 | |||||||
| Chlorothionite | K2Cu(SO4)Cl2 | 1:2 | orthorhombic | Pnma | a = 7.73 b = 6.07 c = 16.29 | 764 | 2.67 | pale blue
Biaxial (+) |
[3] |
| Sundiusite | Pb10(SO4)O8Cl2 | 1:2 | monoclinic | a = 24.67 b = 3.781 c = 11.881 β = 100.07 | 1091.1 | Biaxial (+) nα = 2.100 nγ = 2.170
Max birefringence: δ = 0.070 |
[4] | ||
| Sodium Potassium Iron Sulfate Chloride | (Na,K)2Fe(SO4)Cl2 | 1:2 | |||||||
| Mammothite | Pb6Cu4AlSb5+O2(OH)16Cl4(SO4)2 | 1:2 | monoclinic | C2 | a = 18.959 b = 7.3399 c = 11.363 β = 112.428(9)° Z=2 | 1461.6 | 5.21 | blue-green
Biaxial (+) nα = 1.868 nβ = 1.892 nγ = 1.928 2V:measured: 80° Birefringence: 0.060 |
[5] |
| Zn Sulfate Chloride Hydroxide | Zn3(SO4)(Cl,OH)2 | 1:2 | [6] | ||||||
| Tatarskite | Ca6Mg2(SO4)2(CO3)2(OH)4Cl4 · 7H2O | 2:4 | Orthorhombic | 2.431 | Biaxial (-) nα = 1.567 nβ = 1.654 nγ = 1.722
2V: 83° |
[7] | |||
| Therasiaite | (NH4)3KNa2Fe2+Fe3+(SO4)3Cl5 | 3:5 | monoclinic | a = 18.284, b = 12.073, c = 9.535 Å, β = 108.10°, and Z = 4 | V = 2000.6 Å3 | brown | [8] | ||
| Acmonidesite | (NH4,K,Pb)8NaFe2+4(SO4)5Cl8 | 5:8 | orthorhombic | a = 9.841 Å, b = 19.448 Å, c = 17.847 Å Z=4 | 3,415.70 Å3 | [9] | |||
| 'Ammonium-Kainite' | NH4Mg(SO4)Cl•3H2O | 1:1 | |||||||
| Anhydrokainite | KMg(SO4)Cl | 1:1 | [10] | ||||||
| Belousovite | KZn(SO4)Cl | 1:1 | monoclinic | P21/c | a = 6.8904 b = 9.6115 c = 8.2144 β = 96.582 Z = 4 | 540.43 | [11] | ||
| Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O | 1:1 | trigonal | P3 | a=8.35 c=13.08 | 802.67 | Uniaxial (-) nω = 1.561 nε = 1.538
Max birefringence: δ = 0.023 |
[12] | |
| Kainite | KMg(SO4)Cl · 3H2O | 1:1 | monoclinic | a = 19.72 b = 16.23 c = 9.53 β = 94.92° | 3,039 | 2.15 | Biaxial (-) nα = 1.494 nβ = 1.505 nγ = 1.516
2V: measured: 90° , calculated: 88° Max birefringence: δ = 0.022 |
[13] | |
| Spangolite | Cu6Al(SO4)(OH)12Cl · 3H2O | 1:1 | trigonal | P31c | a = 8.24 c = 14.34 Z=2 | 843.2 | 3.14 | blue-green
Uniaxial (-) nω = 1.694 nε = 1.641 Max birefringence: δ = 0.053 |
[14] |
| Thérèsemagnanite | NaCo4(SO4)(OH)6Cl · 6H2O | 1:1 | trigonal | P3 | a = 8.349 c = 13.031 | 786.6 | 2.52 | Uniaxial (-) ω=1.792 nε=1.786
Max birefringence: δ = 0.006 |
[15][16] |
| Vendidaite | Al2(SO4)(OH)3Cl·6H2O | 1:1 | monoclinic | C2/c | a = 11.925 b = 16.134 c = 7.4573 β = 125.815° | 1163.4 | 1.97 | Biaxial (+) nα = 1.522 nβ = 1.524 nγ = 1.527
2V: calculated: 79° Max birefringence: δ = 0.005 |
[17] |
| Xitieshanite | Fe3+(SO4)Cl · 6H2O | 1:1 | monoclinic | P21/a | a = 14.102 b = 6.908 c = 10.673 β = 111.26° Z=4 | 968.97 | 1.99 | Biaxial (+) nα = 1.536 nβ = 1.570 nγ = 1.628
2V: measured: 77° , calculated: 78° Max birefringence: δ = 0.092 |
[18] |
| Zn Sulfate-Hydroxide-Chloride-Hydrate | Zn9(SO4)2(OH)12Cl2 · 6H2O | 2:2 | trigonal | R3 | a = 8.275 c = 32.000 Z=3 | 1,897.6 | [19] | ||
| Gordaite-related Ca-Zn Sulfate Chloride Hydrate | Ca[Zn8(SO4)2(OH)12Cl2](H2O)9 | 2:2 | trigonal | R3c | a = 8.3797 Å, c = 68.123 Z=6 | 4142.7 | [20] | ||
| UM1987-14-SO:ClHZn | Zn12(SO4)3Cl3(OH)15•5H2O | 3:3 | |||||||
| Aubertite | CuAl(SO4)2Cl · 14H2O | 2:1 | triclinic | P1 | a=6.28 b=13.23 c=6.28 α=91.17°, β=94.67°, γ=82.45° | 515.50 | 1.815 | blue
Biaxial (-) nα = 1.462 nβ = 1.482 nγ = 1.495 2V: measured: 71° , calculated: 76° Max birefringence: δ = 0.033 |
[21] |
| Magnesioaubertite | (Mg,Cu)Al(SO4)2Cl · 14H2O | 2:1 | triclinic | P1 | a = 6.31 b = 13.20 c = 6.29 α = 91.74°, β = 94.55°, γ = 82.62° | 517.8 | Biaxial (-) nα = 1.466 nβ = 1.481 nγ = 1.488
2V: measured: 112° to 114°, calculated: 66° Max birefringence: δ = 0.022 |
[22] | |
| Kamchatkite | KCu3(SO4)2OCl | 2:1 | orthorhombic | Pnma | a = 9.755 b = 7.015 c = 12.866 | 881.8 | 3.48 | greenish-yellow
Biaxial (+) nα = 1.695 nβ = 1.718 nγ = 1.759 2V: measured: 75° , calculated: 76° Max birefringence: δ = 0.064 |
[23] |
| Aiolosite | Na4Bi(SO4)3Cl | 3:1 | hexagonal | P63/m | a = 9.626 c = 6.880 | 552.1 | 3.589 | Uniaxial (+) nω = 1.590 nε = 1.600
Max birefringence: δ = 0.010 |
[24] |
| Caracolite | Na3Pb2(SO4)3Cl | 3:1 | monoclinic | P63/m | a = 19.62 b = 7.14 c = 9.81 β = 120° | 1190 | 5.1 | Biaxial (-) nα = 1.743 nβ = 1.754 nγ = 1.764
Max Birefringence: δ = 0.021 |
[25] |
| D'Ansite | Na21Mg(SO4)10Cl3 | 10:3 | isometric | I43d | a = 15.913 Z = 4 | 4,029.55 | 2.59 | isotropic n=1.488 | [26] |
| D'Ansite-(Fe) | Na21Fe2+(SO4)10Cl3 | 10:3 | isometric | I43d |
a = 15.882 Z=4 |
4,006.04 | 2.62 | Isotropic n = 1.51 | [27] |
| D'Ansite-(Mn) | Na21Mn2+(SO4)10Cl3 | 10:3 | isometric | I43d | a = 15.929 Z=4 | 4,041.79 | 2.610 | Isotropic n = 1.50 | [28] |
| Adranosite | (NH4)4NaAl2(SO4)4Cl(OH)2 | 4:1 | tetragonal | I41/acd | a = 18.118, c = 11.320 | 3,715.9 | [29] | ||
| Adranosite-(Fe) | (NH4)4NaFe3+2(SO4)4Cl(OH)2 | 4:1 | tetragonal | I41/acd | a = 18.261, c = 11.562 Z=8 | 3855.5 | Uniaxial (-) nω = 1.580 nε = 1.570 Birefringence: δ = 0.010 | [30] | |
| Bluelizardite | Na7(UO2)(SO4)4Cl(H2O)2 | 4:1 | monoclinic | C2/c | a = 21.1507 b = 5.3469 c = 34.6711 β = 104.913° Z=8 | 3788.91 | 3.116 | yellow
Biaxial (-) nα = 1.515(1) nβ = 1.540(1) nγ = 1.545(1) 2V: measured: 48°, calculated: 47.6° Max birefringence: δ = 0.030 |
[31] |
| Piypite | K4Cu4O2(SO4)4 · (Na,Cu)Cl | 4:1 | Tetragonal | a = 13.6 c = 4.95 Z=2 | 915.6 | 3.1 | green
Uniaxial (+) nω = 1.583 nε = 1.695 Max Birefringence:δ = 0.112 |
[32] | |
| Atlasovite | K(BiO)Cu6Fe3+(SO4)5O3Cl | 5:1 | tetragonal | P4/ncc | a = 9.86, c = 20.58 | 2,001 | 4.2 | Uniaxial (-) nω = 1.783 nε = 1.776 Birefringence: δ = 0.007 | [33] |
| Three or more anions | |||||||||
| Marinellite | (Na,K)42Ca6(Al6Si6O24)6(SO4)8Cl2 · 3H2O | 2:8 | Trigonal | P31c | a = 12.88 c = 31.761 | 4563 | 2.405 | Uniaxial (+) nω = 1.495 nε = 1.497
Max birefringence: δ = 0.002 |
[34] |
| Philolithite | Pb12O6Mn7(SO4)(CO3)4Cl4(OH)12 | 1:4 | Tetragonal | a = 12.627 c = 12.595 Z=2 | 2008.2 | green
Biaxial (+) nα = 1.920 nβ = 1.940 nγ = 1.950 Max birefringence: δ = 0.030 |
[35] | ||
| Symesite | Pb10(SO4)O7Cl4 · H2O | 1:4 | triclinic | P1 | a = 8.821 b = 10.776 c = 13.134 α = 68.96°, β = 86.52°, γ = 75.65° Z=2 | 1128.4 | 7.3 | pink
Biaxial nα = 2.120 nγ = 2.160 Max birefringence: δ = 0.040 |
[36] |
| Bobmeyerite | Pb4(Al3Cu)(Si4O12)(S0.5Si0.5O4)(OH)7Cl(H2O)3 | 1:2 | Orthorhombic | Pnnm | a = 13.969 b = 14.24 c = 5.893 Z=2 | 1173.6 | 4.381 | Biaxial (-) nα = 1.756(4) nβ = 1.759(2) nγ = 1.759(2)
Max birefringence: δ = 0.003 |
[37] |
| Microsommite | Na4K2Ca2(Al6Si6O24)(SO4)Cl2 | 1:2 | Hexagonal | a = 22.08 c = 5.33 | 2,250 | Uniaxial (+) nω = 1.521 nε = 1.529
Max birefringence: δ = 0.008 |
[38] | ||
| Mattheddleite | Pb5(SiO4)1.5(SO4)1.5(Cl,OH) | 3:2 | Hexagonal | P63/m | a = 10.0056, c = 7.496 Z=2 | 649.9 | 6.96 | Uniaxial (-) nω = 2.017 nε = 1.999 Birefringence: δ = 0.018 | [39] |
| Afghanite | (Na,K)22Ca10[Si24Al24O96](SO4)6Cl6 | 6:6 | Trigonal | a = 12.796, c = 21.409 Z = 1 | 3,015.16 | 2.54 | Uniaxial (+) nω = 1.523 nε = 1.529 δ = 0.006 | [40] | |
| Alloriite | (Na,Ca,K)26Ca4(Al6Si6O24)4(SO4)6Cl6 | 6:6 | trigonal | P31c | a = 12.892 c = 21.340 Z=4 | 3,071.61 | 2.35 | Uniaxial (+) nω = 1.497(2) nε = 1.499(2)
Max birefringence: δ = 0.002 |
[41] |
| Eztlite | Pb2+2Fe3+3(Te4+ O3)3(SO4)O2Cl | 1:1 | monoclinic | Cm | a = 11.466 b = 19.775 c = 20.52 β = 20.52° Z=2 | 2322.6 | 4.5 | red
Biaxial nα = 2.140 nγ = 2.150 Max birefringence: δ = 0.010 |
[42] |
| Vlodavetsite | AlCa2(SO4)2F2Cl · 4H2O | 1:1 | Tetragonal | I4/m | a = 6.870, c = 13.342 Z=2 | 629.70 | Uniaxial (+) nω = 1.509 nε = 1.526
Birefringence: δ = 0.017 |
[43] | |
| Liottite | (Na,K)16Ca8(Al6Si6O24)3(SO4)5Cl4 | 5:4 | Hexagonal | a = 12.84 c = 16.09 | 2,297 | Uniaxial (-) nω = 1.530 nε = 1.528
Max birefringence: δ = 0.002 |
[44] | ||
| Chlorellestadite | Ca10(SiO4)3(SO4)3Cl2 | 3:2 | Hexagonal | P63/m | a = 9.6002 c = 6.8692 Z=2 | 548.27 | 3.091 | Uniaxial (-) nω = 1.664 nε = 1.659
Max birefringence δ = 0.005 |
[45] |
| Heidornite | Na2Ca3B5O8(SO4)2Cl(OH)2 | 2:1 | monoclinic | a = 10.19 b = 7.76 c = 18.81 β = 93.33° Z=4 | 1,484.88 | 2.753 | Biaxial (+) nα = 1.579 nβ = 1.588 nγ = 1.604
2V: measured: 63° to 77°, calculated: 76° Max birefringence: δ = 0.025 |
[46] | |
| Mineevite-(Y) | Na25Ba(Y,Gd,Dy)2(CO3)11(HCO3)4(SO4)2F2Cl | 2:1 | hexagonal | P63/m | a = 8.811 c = 37.03 | 2,489.6 | 2.85 | Pale green
Uniaxial (-) nω = 1.536 nε = 1.510 Max birefringence: δ = 0.026 |
[47] |
| Sulphohalite | Na6(SO4)2FCl | 2:1 | Isometric | Fm3m | a = 10.065, Z = 4 | 1,019.6 | isotropic n=1.455 | [48][49] | |
| Tounkite | (Na,Ca,K)8(Al6Si6O24)(SO4)2Cl · H2O | 2:1 | hexagonal | a = 12.84 c = 32.23 | 4,602 | Uniaxial (+) nω = 1.528 nε = 1.543
Max birefringence: δ = 0.015 |
[50] | ||
| Alloriite | Na19K6Ca5[Al22Si26O96](SO4)5Cl(CO3)x(H2O) | 5:1 | trigonal | P31c | a = 12.892 c = 21.340 | [51] | |||
| Galeite | Na15(SO4)5F4Cl | 5:1 | trigonal | a = 12.17 c = 13.94 | 1788 | Uniaxial (+) nω = 1.447 nε = 1.449
Max birefringence: δ = 0.002 |
|||
| Nabokoite | KCu7(SO4)5(Te4+O3)OCl | 5:1 | Tetragonal | a = 9.84 Å, c = 20.52 | 1,986.86 | nω = 1.778 nε = 1.773 uniaxial (-) | [52] | ||
| Schairerite | Na21(SO4)7ClF6 | 7:1 | Trigonal | a = 12.17 c = 19.29 | 2,474 | 2.612 | Uniaxial (+) nω = 1.440 nε = 1.445
Max birefringence: δ = 0.005 |
[53] | |
| Hanksite | Na22K(SO4)9(CO3)2Cl | 9:1 | Hexagonal | P 63/m | a = 10.4896 c = 21.2415 | 2024.1 | [54] | ||
| Sacrofanite | (Na61K19Ca32)(Si84Al84O336)(SO4)26Cl2F6•2H2O | 26:2 | hexagonal | P62c | a = 12.86 c = 72.24 Z=14 | 10,346 | 2.423 | Uniaxial (-) nω = 1.505 nε = 1.486
Max birefringence:δ = 0.019 |
[55] |
Artificial
| name | formula | ratio
SO4:Cl |
system | space group | unit cell | volume | density | optical | references |
|---|---|---|---|---|---|---|---|---|---|
| 'Ammonium-zinc-Kainite' | NH4Zn(SO4)Cl•3H2O | 1:1 | |||||||
| nonasodium tetrakis(sulfate) chloride diperhydrate | Na9[SO4]4Cl·2H2O2 | 4:1 | tetragonal | P 4/n | MW=694.63 a=29.6829 b=29.6829 c=8.4018 Z=16 | 7402.6 | 2.493 | colourless | [56] |
| 'zinc-Kainite' | KZn(SO4)Cl•3H2O | 1:1 | n=1.24 | [57] | |||||
| indium sulfate chloride | In2(SO4)3•InCl3•(17±1)H2O | 3:3 | [58] | ||||||
| Na3Ca2(SO4)3Cl | 3:1 | hexagonal | P63/m | [59] | |||||
| Na3Ca2(SO4)3Cl | 3:1 | orthorhombic >897K | [60] | ||||||
| Na3Cd2(SO4)3Cl | 3:1 | hexagonal | P63/m | [59] | |||||
| Na3Cd2(SO4)3Cl | 3:1 | monoclinic >494K | [60] | ||||||
| K3Ca2(SO4)3Cl | 3:1 | [61] | |||||||
| K3Pb2(SO4)3Cl | 3:1 | [62] | |||||||
| K4Sb(SO4)3Cl | 3:1 | noncentrosymmetric | non-linear optic high birefringence. | [63] | |||||
| Calcium chlorosulfatosilicate | Ca10(SiO4)3(SO4)3Cl2 | 3:2 | hexagonal | a=9.688 c=6.849 | monoaxial,(-) , No = 1.665, Ne' = 1.659 | [64] | |||
| [Fe2Al4(OH)11](SO4)3Cl | 3:1 | ||||||||
| Lithium gordaite | LiZn4(OH)6(SO4)Cl·6H2O | 1:1 | ?c=17.84 | [65] | |||||
| K3Sn2(SO4)3Cl | 3:1 | stable to 440°C | [66] | ||||||
| Rb3Sn2(SO4)2Cl3 | 2:3 | monoclinic | C2/m | a=21.153 b=5.1751 c= 6.9327 β =95.844 Z=2 | 754.97 | 3.485 | stable to 350°C | [66] | |
| (NH4)SbCl2(SO4) | 1:2 | orthorhombic | P212121 | a=6.3616 b=7.3110 c=15.827 Z=2 | 736.13 | 2.768 | colourless SHG 1.7×KDP | [67] | |
| (NH4)2SbCl(SO4)2 | 2:1 | orthorhombic | Pnma | a=8.6044 b=16.5821 c=7.1007 Z=2 | 1013.1 | 2.527 | colourless | [67] | |
| RbSbSO4Cl2 | 1:2 | orthorhombic | P212121 | a=6.3469 b=7.4001 c=15.7798 Z=2 | 741.14 | 3.353 | SHG 2.7×KDP | [68] | |
| Cs3Sn2(SO4)2Cl3 | monoclinic | C2/m | a=22.222 b=5.1992 c= 7.2661 β =97.030 Z=2 | 833.17 | 3.725 | stable to 190°C | [66] | ||
| gadolinium chloride sulfate | GdClSO4 | 1:1 | monoclinic | P21/c | a = 9.437 6.5759 6.8005 β = 104.87 Z=4 | [69] | |||
| KBiCl2SO4 | 1:2 | orthorhombic | P212121 | a= 7.2890 b=6.3673 c=15.3306 Z=4 | 711.51 | 3.875 | band gap 3.95 eV | [70] | |
| RbBiCl2SO4 | 1:2 | orthorhombic | P212121 | a= 6.3352 b=7.4450 c=15.5302 Z=4 | 732.49 | 4.184 | colourless NLO SHG | [71] | |
| NH4BiCl2SO4 | 1:2 | orthorhombic | P212121 | a=7.3845 b=6.3593 c=15.5636 Z=4 | 730.87 | 3.581 | colourless NLO SHG | [71] | |
| Tripotassium dibismuth pentachloride dioxide disulfate | K3Bi2Cl5O2(SO4)2 | 2:5 | triclinic | P1 | a=6.513 b=7.2500 c=10.7916 al=82.500 be=83.742 ga=82.100 | 485.89 | band gap 3.62 eV | [72] | |
| K4[(NpO2)(SO4)2]Cl | 2:1 | monoclinic | P2/n | a=10.0873 b=4.5354 c=14.3518 β=103.383 Z=2 | 638.76 | 3.395 | light green | [73] | |
| Rb4[(NpO2)(SO4)2]Cl | 2:1 | monoclinic | P2/n | a=10.5375 b=4.6151 c=16.068 β=103.184 Z=2 | 599.33 | 3.982 | light green | [73] | |
| complexes | |||||||||
| [Pt2(SO4)4Cl(H2O)]3- | 4:1 | [74] | |||||||
| Hf(SO4)2Cl− | 2:1 | [75] | |||||||
Some "chloride sulfates" are sold as solutions in water and used for water treatment. these include ferric chloride sulfate and polyaluminium sulfate chloride. The solutions may also be called "chlorosulfates" even though they do not contain a chlorosulfate group.
References
- "Arzrunite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Connellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Chlorothionite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Sundiusite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Mammothite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Unnamed (Zn Sulfate Chloride Hydroxide): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Tatarskite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-05-15.
- Demartin, F.; Castellano, C.; Campostrini, I. (February 2014). "Therasiaite, (NH 4 ) 3 KNa 2 Fe 2+ Fe 3+ (SO 4 ) 3 Cl 5 , a new sulfate chloride from La Fossa Crater, Vulcano, Aeolian islands, Italy". Mineralogical Magazine. 78 (1): 203–213. Bibcode:2014MinM...78..203D. doi:10.1180/minmag.2014.078.1.14. ISSN 0026-461X. S2CID 101488742.
- "Acmonidesite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-04-20.
- "Anhydrokainite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- Siidra, Oleg I.; Nazarchuk, Evgeny V.; Lukina, Evgeniya A.; Zaitsev, Anatoly N.; Shilovskikh, Vladimir V. (October 2018). "Belousovite, KZn(SO 4 )Cl, a new sulfate mineral from the Tolbachik volcano with apophyllite sheet-topology". Mineralogical Magazine. 82 (5): 1079–1088. Bibcode:2018MinM...82.1079S. doi:10.1180/minmag.2017.081.084. ISSN 0026-461X.
- Nasdala, Lutz; Witzke, Thomas; Ullrich, Bernd; Brett, Robin (1998-10-01). "Gordaite [Zn 4 Na(OH) 6 (SO 4 )Cl.6H 2 O]; second occurrence in the Juan de Fuca Ridge, and new data". American Mineralogist. 83 (9–10): 1111–1116. Bibcode:1998AmMin..83.1111N. doi:10.2138/am-1998-9-1020. ISSN 0003-004X. S2CID 101267874.
- "Kainite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Spangolite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- Kasatkin, Anatoly V.; Plášil, Jakub; Škoda, Radek; Belakovskiy, Dmitriy I.; Marty, Joe; Meisser, Nicolas; Pekov, Igor V. (February 2018). "Redefinition of thérèsemagnanite, NaCo 4 (SO 4 )(OH) 6 Cl·6H 2 O: new data and relationship to 'cobaltogordaite'". Mineralogical Magazine. 82 (1): 159–170. Bibcode:2018MinM...82..159K. doi:10.1180/minmag.2017.081.030. ISSN 0026-461X.
- "Mineralienatlas - Fossilienatlas". www.mineralatlas.eu (in German). Retrieved 2020-06-19.
- "Vendidaite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Xitieshanite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Unnamed (Zn Sulphate-Hydroxide-Chloride-Hydrate): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Unnamed (Gordaite-related Ca-Zn Sulphate Chloride Hydrate): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Aubertite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Magnesioaubertite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Kamchatkite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Aiolosite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Caracolite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "DAnsite Mineral Data". webmineral.com. Retrieved 2020-06-19.
- "D'Ansite-(Fe): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "D'Ansite-(Mn): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Adranosite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-04-20.
- "Adranosite-(Fe): Mineral information, data and localities". www.mindat.org. Retrieved 2020-04-20.
- "Bluelizardite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Piypite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Atlasovite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-05-23.
- "Marinellite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Philolithite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Symesite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Bobmeyerite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Microsommite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Mattheddleite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-05-22.
- "Afghanite Mineral Data". www.webmineral.com. Retrieved 2020-05-22.
- Chukanov, N. V.; Rastsvetaeva, R. K.; Pekov, I. V.; Zadov, A. E. (December 2007). "Alloriite, Na5K1.5Ca(Si6Al6O24)(SO4)(OH)0.5 · H2O, a new mineral species of the cancrinite group". Geology of Ore Deposits. 49 (8): 752–757. Bibcode:2007GeoOD..49..752C. doi:10.1134/S1075701507080090. ISSN 1075-7015. S2CID 95275754.
- "Eztlite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Vlodavetsite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-05-22.
- "Liottite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Chlorellestadite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Heidornite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Mineevite-(Y): Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Sulphohalite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- "Sulphohalite Mineral Data". www.webmineral.com. Retrieved 2020-06-19.
- "Tounkite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- Kaneva, Ekaterina (2015-09-01). "Investigation of the sulfur speciation in cancrinite group minerals using Single crystal X-ray diffraction analysis [in Russian]". Cite journal requires
|journal=(help) - "Nabokoite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-05-18.
- "Schairerite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- Callegari, Athos Maria; Boiocchi, Massimo; Zema, Michele; Tarantino, Serena Chiara (2018-08-01). "The crystal structure of hanksite, Na 22 K(CO 3 ) 2 (SO 4 ) 9 Cl, refined from high-resolution X-ray diffraction data". Neues Jahrbuch für Mineralogie - Abhandlungen. 195 (2): 115–122. doi:10.1127/njma/2018/0113. ISSN 0077-7757.
- "Sacrofanite: Mineral information, data and localities". www.mindat.org. Retrieved 2020-06-19.
- Pritchard, Robin Gavin; Begum, Zubeda; Lau, Yuf Fai; Austin, Jonothan (2005-12-01). "Structures of Na 9 [SO 4 ] 4 X ·2H 2 O 2 , where X = Cl or Br, in which the halide anions orchestrate extended orientation sequences of H 2 O 2 solvate molecules". Acta Crystallographica Section B Structural Science. 61 (6): 663–668. doi:10.1107/S010876810503212X. ISSN 0108-7681. PMID 16306673.
- Abu El-Fadl, A.; Abd-Elsalam, A.M. (25 September 2018). "Influence of nickel substitutions on the structural, optical and spectroscopic properties of potassium zinc chloride sulfate single crystals". Journal of Taibah University for Science. 12 (6): 826–836. doi:10.1080/16583655.2018.1524353. S2CID 106321274.
- Kartzmark, Elinor M. (August 1977). "Double salts of indium trichloride with the alkali chlorides, with ammonium chloride, and with indium sulfate". Canadian Journal of Chemistry. 55 (15): 2792–2798. doi:10.1139/v77-388.
- Perret, René; Bouillet, Anne-Marie (1975). "Les apatites˗sulfates Na3Cd2 (SO4)3Cl et Na3Pb2 (SO4)3Cl". Bulletin de Minéralogie. 98 (4): 254–255. doi:10.3406/bulmi.1975.6997.
- Knyazev, A. V.; Bulanov, E. N.; Korokin, V. Zh. (May 2014). "Synthesis and thermal expansion of M 3 I M 2 II (SO4)3L (L = Halogen) compounds with the apatite structure". Inorganic Materials. 50 (5): 519–527. doi:10.1134/S0020168514050069. ISSN 0020-1685. S2CID 98085409.
- Baig, N.; Dhoble, N. S.; Park, K.; Kokode, N. S.; Dhoble, S. J. (June 2015). "Enhanced luminescence and white light emission from Eu 3+ -co-doped K 3 Ca 2 (SO 4 ) 3 Cl:Dy 3+ phosphor with near visible ultraviolet excitation for white LEDs: Eu 3+ -co-doped K 3 Ca 2 (SO 4 ) 3 Cl:Dy 3+ phosphor". Luminescence. 30 (4): 479–484. doi:10.1002/bio.2763. PMID 25223265.
- Niemi, Jonne (2019-11-22). Effects of Temperature Gradient on Ash Deposit Aging and Heat Exchanger Corrosion. Åbo Akademi University. ISBN 978-952-12-3866-6.
- Yang, Fei; Wang, Lei; Ge, Yuwei; Huang, Ling; Gao, Daojiang; Bi, Jian; Zou, Guohong (September 2020). "K4Sb(SO4)3Cl: The first apatite-type sulfate ultraviolet nonlinear optical material with sharply enlarged birefringence". Journal of Alloys and Compounds. 834: 155154. doi:10.1016/j.jallcom.2020.155154.
- Chen, Mingyuan; Fang, Yi (March 1989). "The chemical composition and crystal parameters of calcium chlorosulfatosilicate". Cement and Concrete Research. 19 (2): 184–188. doi:10.1016/0008-8846(89)90082-3.
- Maruyama, Swami Arêa; Westrup, Kátia Cristina Molgero; Nakagaki, Shirley; Wypych, Fernando (April 2017). "Immobilization of a cationic manganese(III) porphyrin on lithium gordaite (LiZn4(OH)6(SO4)Cl·6H2O), a layered hydroxide salt with cation exchange capacity". Applied Clay Science. 139: 108–111. doi:10.1016/j.clay.2017.01.010.
- Ge, Yuwei; Wang, Qiang; Yang, Fei; Huang, Ling; Gao, Daojiang; Bi, Jian; Zou, Guohong (2021-05-14). "Tin Chloride Sulfates A 3 Sn 2 (SO 4 ) 3– x Cl 1+2 x (A = K, Rb, Cs; x = 0, 1) as Multifunctional Optical Materials". Inorganic Chemistry: acs.inorgchem.1c01037. doi:10.1021/acs.inorgchem.1c01037. ISSN 0020-1669.
- He, Fangfang; Wang, Qian; Hu, Cuifang; He, Wen; Luo, Xueying; Huang, Ling; Gao, Daojiang; Bi, Jian; Wang, Xin; Zou, Guohong (2018-10-03). "Centrosymmetric (NH 4 ) 2 SbCl(SO 4 ) 2 and Non-centrosymmetric (NH 4 )SbCl 2 (SO 4 ): Synergistic Effect of Hydrogen-Bonding Interactions and Lone-Pair Cations on the Framework Structures and Macroscopic Centricities". Crystal Growth & Design. 18 (10): 6239–6247. doi:10.1021/acs.cgd.8b01102. ISSN 1528-7483.
- He, Fangfang; Deng, Yalan; Zhao, Xiaoyu; Huang, Ling; Gao, Daojiang; Bi, Jian; Wang, Xin; Zou, Guohong (2019-05-16). "RbSbSO4Cl2: an excellent sulfate nonlinear optical material generated due to the synergistic effect of three asymmetric chromophores". Journal of Materials Chemistry C. 7 (19): 5748–5754. doi:10.1039/C9TC01249D. ISSN 2050-7534.
- Wickleder, Mathias S. (1999). "Halogenidsulfate des Gadoliniums: Synthese und Kristallstruktur von GdClSO4 und GdFSO4". Zeitschrift für anorganische und allgemeine Chemie (in German). 625 (5): 725–728. doi:10.1002/(SICI)1521-3749(199905)625:5<725::AID-ZAAC725>3.0.CO;2-T. ISSN 1521-3749.
- Yue, Zeng-Hao; Lu, Zhen-Tao; Xue, Huai-Guo; Guo, Sheng-Ping (2019-07-03). "KBiCl 2 SO 4 : The First Bismuth Chloride Sulfate Being Second-Order Nonlinear Optical Active". Crystal Growth & Design. 19 (7): 3843–3850. doi:10.1021/acs.cgd.9b00291. ISSN 1528-7483.
- Chen, Kaichuang; Yang, Yi; Peng, Guang; Yang, Shunda; Yan, Tao; Fan, Huixin; Lin, Zheshuai; Ye, Ning (2019). "A 2 Bi 2 (SO 4 ) 2 Cl 4 (A = NH 4 , K, Rb): achieving a subtle balance of the large second harmonic generation effect and sufficient birefringence in sulfate nonlinear optical materials". Journal of Materials Chemistry C. 7 (32): 9900–9907. doi:10.1039/C9TC03105G. ISSN 2050-7526.
- Lu, Zhen‐Tao; Chi, Yang; Xue, Huai‐Guo; Guo, Sheng‐Ping (2018-07-13). "K 3 Bi 2 Cl 5 O 2 (SO 4 ) 2 : A Novel Pentanary Chloride Oxide Sulfate". ChemistrySelect. 3 (26): 7608–7611. doi:10.1002/slct.201801307. ISSN 2365-6549.
- Forbes, Tori M. (2007-08-15). The Crystal Chemistry of Neptunium Compounds: Structural Relationships to U6+ Mineralogy (Thesis). University Of Notre Dame.
- Dunham, Stephen Oliver (June 1992). "THE SYNTHESIS OF ONE-DIMENSIONAL PLATINUM COMPLEXES; MECHANISTIC STUDIES FROM MULTINUCLEAR NMR" (PDF). MONTANA STATE UNIVERSITY.
- Rice, Nevill; Lee, Robyn (2008-09-14). The Effect Of Aqueous Phase Composition On The Separation Of Hafnium And Zirconium From Acidic Chloride-Sulphate Media By Extraction With Alamine 336s In Benzene. International Solvent Extraction Conference.